C41H55NO6 — CID 102572532
[4-[(4-decoxybenzoyl)amino]-7-oxocyclohepta-1,3,5-trien-1-yl] 4-decoxybenzoate (PubChem CID 102572532) has the molecular formula C41H55NO6 and a molecular weight of 657.89 g/mol. Its IUPAC name is [4-[(4-decoxybenzoyl)amino]-7-oxocyclohepta-1,3,5-trien-1-yl] 4-decoxybenzoate.
| Compound Name | [4-[(4-decoxybenzoyl)amino]-7-oxocyclohepta-1,3,5-trien-1-yl] 4-decoxybenzoate |
|---|---|
| PubChem CID | 102572532 |
| Molecular Formula | C41H55NO6 |
| Molecular Weight | 657.89 g/mol |
| Exact Mass | 657.40 |
| IUPAC Name | [4-[(4-decoxybenzoyl)amino]-7-oxocyclohepta-1,3,5-trien-1-yl] 4-decoxybenzoate |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Nc2ccc(OC(=O)c3ccc(OCCCCCCCCCC)cc3)c(=O)cc2)cc1 |
| InChI | InChI=1S/C41H55NO6/c1-3-5-7-9-11-13-15-17-31-46-36-25-19-33(20-26-36)40(44)42-35-23-29-38(43)39(30-24-35)48-41(45)34-21-27-37(28-22-34)47-32-18-16-14-12-10-8-6-4-2/h19-30H,3-18,31-32H2,1-2H3,(H,42,44) |
| InChIKey | GVRCUGBBGPRYSE-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.89 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|