About [4-[(4-butoxyphenyl)diazenyl]phenyl] 3-bromopropanoate
[4-[(4-butoxyphenyl)diazenyl]phenyl] 3-bromopropanoate (PubChem CID 71443458) has the molecular formula C19H21BrN2O3
and a molecular weight of 405.29 g/mol. Its IUPAC name is [4-[(4-butoxyphenyl)diazenyl]phenyl] 3-bromopropanoate.
Molecular Properties
| Compound Name | [4-[(4-butoxyphenyl)diazenyl]phenyl] 3-bromopropanoate |
| PubChem CID | 71443458 |
| Molecular Formula | C19H21BrN2O3 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | [4-[(4-butoxyphenyl)diazenyl]phenyl] 3-bromopropanoate |
| SMILES | CCCCOc1ccc(/N=N/c2ccc(OC(=O)CCBr)cc2)cc1 |
| InChI | InChI=1S/C19H21BrN2O3/c1-2-3-14-24-17-8-4-15(5-9-17)21-22-16-6-10-18(11-7-16)25-19(23)12-13-20/h4-11H,2-3,12-14H2,1H3/b22-21+ |
| InChIKey | FZDMADQAPYSNIS-QURGRASLSA-N |
| XLogP | 5.97 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[(4-butoxyphenyl)diazenyl]phenyl] 3-bromopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(4-butoxyphenyl)diazenyl]phenyl] 3-bromopropanoate?
The IUPAC name of [4-[(4-butoxyphenyl)diazenyl]phenyl] 3-bromopropanoate (CID 71443458) is [4-[(4-butoxyphenyl)diazenyl]phenyl] 3-bromopropanoate.
What is the SMILES notation for [4-[(4-butoxyphenyl)diazenyl]phenyl] 3-bromopropanoate?
The canonical SMILES for [4-[(4-butoxyphenyl)diazenyl]phenyl] 3-bromopropanoate is CCCCOc1ccc(/N=N/c2ccc(OC(=O)CCBr)cc2)cc1.
What is the InChIKey of [4-[(4-butoxyphenyl)diazenyl]phenyl] 3-bromopropanoate?
The InChIKey is FZDMADQAPYSNIS-QURGRASLSA-N. The full InChI is InChI=1S/C19H21BrN2O3/c1-2-3-14-24-17-8-4-15(5-9-17)21-22-16-6-10-18(11-7-16)25-19(23)12-13-20/h4-11H,2-3,12-14H2,1H3/b22-21+.
What are the key properties of [4-[(4-butoxyphenyl)diazenyl]phenyl] 3-bromopropanoate?
[4-[(4-butoxyphenyl)diazenyl]phenyl] 3-bromopropanoate has a molecular weight of 405.29 g/mol, XLogP of 5.97, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(4-butoxyphenyl)diazenyl]phenyl] 3-bromopropanoate is sourced from PubChem (CID 71443458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).