C29H42O6 — CID 18951538
3-decoxy-5-[6-(3,4-dihydroxyphenyl)hexoxy]benzoic acid (PubChem CID 18951538) has the molecular formula C29H42O6 and a molecular weight of 486.65 g/mol. Its IUPAC name is 3-decoxy-5-[6-(3,4-dihydroxyphenyl)hexoxy]benzoic acid.
| Compound Name | 3-decoxy-5-[6-(3,4-dihydroxyphenyl)hexoxy]benzoic acid |
|---|---|
| PubChem CID | 18951538 |
| Molecular Formula | C29H42O6 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | 3-decoxy-5-[6-(3,4-dihydroxyphenyl)hexoxy]benzoic acid |
| SMILES | CCCCCCCCCCOc1cc(OCCCCCCc2ccc(O)c(O)c2)cc(C(=O)O)c1 |
| InChI | InChI=1S/C29H42O6/c1-2-3-4-5-6-7-9-12-17-34-25-20-24(29(32)33)21-26(22-25)35-18-13-10-8-11-14-23-15-16-27(30)28(31)19-23/h15-16,19-22,30-31H,2-14,17-18H2,1H3,(H,32,33) |
| InChIKey | DIBRZNUNPCSEAG-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|