C25H30O5 — CID 23045789
2-[6-[6-(3,4-dihydroxyphenyl)hexoxy]naphthalen-2-yl]acetic acid;methane (PubChem CID 23045789) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is 2-[6-[6-(3,4-dihydroxyphenyl)hexoxy]naphthalen-2-yl]acetic acid;methane.
| Compound Name | 2-[6-[6-(3,4-dihydroxyphenyl)hexoxy]naphthalen-2-yl]acetic acid;methane |
|---|---|
| PubChem CID | 23045789 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 2-[6-[6-(3,4-dihydroxyphenyl)hexoxy]naphthalen-2-yl]acetic acid;methane |
| SMILES | C.O=C(O)Cc1ccc2cc(OCCCCCCc3ccc(O)c(O)c3)ccc2c1 |
| InChI | InChI=1S/C24H26O5.CH4/c25-22-11-7-17(14-23(22)26)5-3-1-2-4-12-29-21-10-9-19-13-18(15-24(27)28)6-8-20(19)16-21;/h6-11,13-14,16,25-26H,1-5,12,15H2,(H,27,28);1H4 |
| InChIKey | UWKRGCQHIAEIDG-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|