C26H30O5 — CID 54294871
ethyl 2-[6-[6-(2,3-dihydroxyphenyl)hexoxy]naphthalen-2-yl]acetate (PubChem CID 54294871) has the molecular formula C26H30O5 and a molecular weight of 422.52 g/mol. Its IUPAC name is ethyl 2-[6-[6-(2,3-dihydroxyphenyl)hexoxy]naphthalen-2-yl]acetate.
| Compound Name | ethyl 2-[6-[6-(2,3-dihydroxyphenyl)hexoxy]naphthalen-2-yl]acetate |
|---|---|
| PubChem CID | 54294871 |
| Molecular Formula | C26H30O5 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | ethyl 2-[6-[6-(2,3-dihydroxyphenyl)hexoxy]naphthalen-2-yl]acetate |
| SMILES | CCOC(=O)Cc1ccc2cc(OCCCCCCc3cccc(O)c3O)ccc2c1 |
| InChI | InChI=1S/C26H30O5/c1-2-30-25(28)17-19-11-12-22-18-23(14-13-21(22)16-19)31-15-6-4-3-5-8-20-9-7-10-24(27)26(20)29/h7,9-14,16,18,27,29H,2-6,8,15,17H2,1H3 |
| InChIKey | SACGRKWWRBMMGW-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|