C35H55NO6 — CID 54519256
2-(diethylamino)ethyl 3-decoxy-5-[6-(2,3-dihydroxyphenyl)hexoxy]benzoate (PubChem CID 54519256) has the molecular formula C35H55NO6 and a molecular weight of 585.83 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 3-decoxy-5-[6-(2,3-dihydroxyphenyl)hexoxy]benzoate.
| Compound Name | 2-(diethylamino)ethyl 3-decoxy-5-[6-(2,3-dihydroxyphenyl)hexoxy]benzoate |
|---|---|
| PubChem CID | 54519256 |
| Molecular Formula | C35H55NO6 |
| Molecular Weight | 585.83 g/mol |
| Exact Mass | 585.40 |
| IUPAC Name | 2-(diethylamino)ethyl 3-decoxy-5-[6-(2,3-dihydroxyphenyl)hexoxy]benzoate |
| SMILES | CCCCCCCCCCOc1cc(OCCCCCCc2cccc(O)c2O)cc(C(=O)OCCN(CC)CC)c1 |
| InChI | InChI=1S/C35H55NO6/c1-4-7-8-9-10-11-13-16-23-40-31-26-30(35(39)42-25-22-36(5-2)6-3)27-32(28-31)41-24-17-14-12-15-19-29-20-18-21-33(37)34(29)38/h18,20-21,26-28,37-38H,4-17,19,22-25H2,1-3H3 |
| InChIKey | YOPNNRFPLPHAON-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.83 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|