C27H34ClN3O3 — CID 136771637
4-[(2-chloro-5-nitrophenyl)diazenyl]-3-[(8E,11E)-pentadeca-8,11-dienyl]phenol (PubChem CID 136771637) has the molecular formula C27H34ClN3O3 and a molecular weight of 484.04 g/mol. Its IUPAC name is 4-[(2-chloro-5-nitrophenyl)diazenyl]-3-[(8E,11E)-pentadeca-8,11-dienyl]phenol.
| Compound Name | 4-[(2-chloro-5-nitrophenyl)diazenyl]-3-[(8E,11E)-pentadeca-8,11-dienyl]phenol |
|---|---|
| PubChem CID | 136771637 |
| Molecular Formula | C27H34ClN3O3 |
| Molecular Weight | 484.04 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 4-[(2-chloro-5-nitrophenyl)diazenyl]-3-[(8E,11E)-pentadeca-8,11-dienyl]phenol |
| SMILES | CCC/C=C/C/C=C/CCCCCCCc1cc(O)ccc1/N=N/c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C27H34ClN3O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-22-20-24(32)17-19-26(22)29-30-27-21-23(31(33)34)16-18-25(27)28/h4-5,7-8,16-21,32H,2-3,6,9-15H2,1H3/b5-4+,8-7+,30-29+ |
| InChIKey | IREONJJXBQSWKX-OUQYGMHTSA-N |
| XLogP | 9.55 |
| TPSA | 88.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.04 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|