C24H36N2O4 — CID 25187213
(Z,8R)-1-(5-nitro-1,3-benzoxazol-2-yl)heptadec-11-en-8-ol (PubChem CID 25187213) has the molecular formula C24H36N2O4 and a molecular weight of 416.56 g/mol. Its IUPAC name is (Z,8R)-1-(5-nitro-1,3-benzoxazol-2-yl)heptadec-11-en-8-ol.
| Compound Name | (Z,8R)-1-(5-nitro-1,3-benzoxazol-2-yl)heptadec-11-en-8-ol |
|---|---|
| PubChem CID | 25187213 |
| Molecular Formula | C24H36N2O4 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | (Z,8R)-1-(5-nitro-1,3-benzoxazol-2-yl)heptadec-11-en-8-ol |
| SMILES | CCCCC/C=C\CC[C@H](O)CCCCCCCc1nc2cc([N+](=O)[O-])ccc2o1 |
| InChI | InChI=1S/C24H36N2O4/c1-2-3-4-5-6-8-11-14-21(27)15-12-9-7-10-13-16-24-25-22-19-20(26(28)29)17-18-23(22)30-24/h6,8,17-19,21,27H,2-5,7,9-16H2,1H3/b8-6-/t21-/m0/s1 |
| InChIKey | YBUWRLFDSNTCBP-LHFJYWTJSA-N |
| XLogP | 6.90 |
| TPSA | 89.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|