C25H39N3O2 — CID 46881973
(Z,8R)-1-(5-anilino-1,3,4-oxadiazol-2-yl)heptadec-11-en-8-ol (PubChem CID 46881973) has the molecular formula C25H39N3O2 and a molecular weight of 413.61 g/mol. Its IUPAC name is (Z,8R)-1-(5-anilino-1,3,4-oxadiazol-2-yl)heptadec-11-en-8-ol.
| Compound Name | (Z,8R)-1-(5-anilino-1,3,4-oxadiazol-2-yl)heptadec-11-en-8-ol |
|---|---|
| PubChem CID | 46881973 |
| Molecular Formula | C25H39N3O2 |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.30 |
| IUPAC Name | (Z,8R)-1-(5-anilino-1,3,4-oxadiazol-2-yl)heptadec-11-en-8-ol |
| SMILES | CCCCC/C=C\CC[C@H](O)CCCCCCCc1nnc(Nc2ccccc2)o1 |
| InChI | InChI=1S/C25H39N3O2/c1-2-3-4-5-6-8-14-19-23(29)20-15-9-7-10-16-21-24-27-28-25(30-24)26-22-17-12-11-13-18-22/h6,8,11-13,17-18,23,29H,2-5,7,9-10,14-16,19-21H2,1H3,(H,26,28)/b8-6-/t23-/m0/s1 |
| InChIKey | YAKKXBOEZRKELL-SJEJWHSFSA-N |
| XLogP | 6.97 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|