C24H38N2O — CID 42604379
(Z,8R)-1-(1H-benzimidazol-2-yl)heptadec-11-en-8-ol (PubChem CID 42604379) has the molecular formula C24H38N2O and a molecular weight of 370.58 g/mol. Its IUPAC name is (Z,8R)-1-(1H-benzimidazol-2-yl)heptadec-11-en-8-ol.
| Compound Name | (Z,8R)-1-(1H-benzimidazol-2-yl)heptadec-11-en-8-ol |
|---|---|
| PubChem CID | 42604379 |
| Molecular Formula | C24H38N2O |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.30 |
| IUPAC Name | (Z,8R)-1-(1H-benzimidazol-2-yl)heptadec-11-en-8-ol |
| SMILES | CCCCC/C=C\CC[C@H](O)CCCCCCCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C24H38N2O/c1-2-3-4-5-6-8-11-16-21(27)17-12-9-7-10-13-20-24-25-22-18-14-15-19-23(22)26-24/h6,8,14-15,18-19,21,27H,2-5,7,9-13,16-17,20H2,1H3,(H,25,26)/b8-6-/t21-/m0/s1 |
| InChIKey | GESXMQMOMAOGEV-LHFJYWTJSA-N |
| XLogP | 6.72 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|