C13H16N2 — CID 96559916
2-[(E)-hex-3-enyl]-1H-benzimidazole (PubChem CID 96559916) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-[(E)-hex-3-enyl]-1H-benzimidazole.
| Compound Name | 2-[(E)-hex-3-enyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 96559916 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2-[(E)-hex-3-enyl]-1H-benzimidazole |
| SMILES | CC/C=C/CCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C13H16N2/c1-2-3-4-5-10-13-14-11-8-6-7-9-12(11)15-13/h3-4,6-9H,2,5,10H2,1H3,(H,14,15)/b4-3+ |
| InChIKey | VSYMKECPVWOGPM-ONEGZZNKSA-N |
| XLogP | 3.46 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|