About bis(2-ethyl-1H-benzimidazole);sulfane
bis(2-ethyl-1H-benzimidazole);sulfane (PubChem CID 68768079) has the molecular formula C18H22N4S
and a molecular weight of 326.47 g/mol. Its IUPAC name is bis(2-ethyl-1H-benzimidazole);sulfane.
Molecular Properties
| Compound Name | bis(2-ethyl-1H-benzimidazole);sulfane |
| PubChem CID | 68768079 |
| Molecular Formula | C18H22N4S |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | bis(2-ethyl-1H-benzimidazole);sulfane |
| SMILES | CCc1nc2ccccc2[nH]1.CCc1nc2ccccc2[nH]1.S |
| InChI | InChI=1S/2C9H10N2.H2S/c2*1-2-9-10-7-5-3-4-6-8(7)11-9;/h2*3-6H,2H2,1H3,(H,10,11);1H2 |
| InChIKey | XZBRGNAZGJDGGW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(2-ethyl-1H-benzimidazole);sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-ethyl-1H-benzimidazole);sulfane?
The IUPAC name of bis(2-ethyl-1H-benzimidazole);sulfane (CID 68768079) is bis(2-ethyl-1H-benzimidazole);sulfane.
What is the SMILES notation for bis(2-ethyl-1H-benzimidazole);sulfane?
The canonical SMILES for bis(2-ethyl-1H-benzimidazole);sulfane is CCc1nc2ccccc2[nH]1.CCc1nc2ccccc2[nH]1.S.
What is the InChIKey of bis(2-ethyl-1H-benzimidazole);sulfane?
The InChIKey is XZBRGNAZGJDGGW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H10N2.H2S/c2*1-2-9-10-7-5-3-4-6-8(7)11-9;/h2*3-6H,2H2,1H3,(H,10,11);1H2.
What are the key properties of bis(2-ethyl-1H-benzimidazole);sulfane?
bis(2-ethyl-1H-benzimidazole);sulfane has a molecular weight of 326.47 g/mol, XLogP of 4.36, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-ethyl-1H-benzimidazole);sulfane is sourced from PubChem (CID 68768079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).