C8H8N3 — CID 58296357
CID 58296357 (PubChem CID 58296357) has the molecular formula C8H8N3 and a molecular weight of 146.17 g/mol.
| Compound Name | CID 58296357 |
|---|---|
| PubChem CID | 58296357 |
| Molecular Formula | C8H8N3 |
| Molecular Weight | 146.17 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | — |
| SMILES | [NH]Cc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C8H8N3/c9-5-8-10-6-3-1-2-4-7(6)11-8/h1-4,9H,5H2,(H,10,11) |
| InChIKey | NSABBWNGRXBSEM-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 52.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.17 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |