C10H14N2O3Si — CID 70659054
3-(1H-benzimidazol-2-yl)propyl-trihydroxysilane (PubChem CID 70659054) has the molecular formula C10H14N2O3Si and a molecular weight of 238.32 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-yl)propyl-trihydroxysilane.
| Compound Name | 3-(1H-benzimidazol-2-yl)propyl-trihydroxysilane |
|---|---|
| PubChem CID | 70659054 |
| Molecular Formula | C10H14N2O3Si |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 3-(1H-benzimidazol-2-yl)propyl-trihydroxysilane |
| SMILES | O[Si](O)(O)CCCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C10H14N2O3Si/c13-16(14,15)7-3-6-10-11-8-4-1-2-5-9(8)12-10/h1-2,4-5,13-15H,3,6-7H2,(H,11,12) |
| InChIKey | AFBCMNCDMJSKEM-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|