C8H8N2Se — CID 583074
2-methylselanyl-1H-benzimidazole (PubChem CID 583074) has the molecular formula C8H8N2Se and a molecular weight of 211.13 g/mol. Its IUPAC name is 2-methylselanyl-1H-benzimidazole.
| Compound Name | 2-methylselanyl-1H-benzimidazole |
|---|---|
| PubChem CID | 583074 |
| Molecular Formula | C8H8N2Se |
| Molecular Weight | 211.13 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | 2-methylselanyl-1H-benzimidazole |
| SMILES | C[Se]c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C8H8N2Se/c1-11-8-9-6-4-2-3-5-7(6)10-8/h2-5H,1H3,(H,9,10) |
| InChIKey | QVMGGBXIEOVFDI-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.13 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|