About 1H-benzimidazole-2-thiolate;ethane;zinc
1H-benzimidazole-2-thiolate;ethane;zinc (PubChem CID 159834857) has the molecular formula C9H11N2SZn-
and a molecular weight of 244.66 g/mol. Its IUPAC name is 1H-benzimidazole-2-thiolate;ethane;zinc.
Molecular Properties
| Compound Name | 1H-benzimidazole-2-thiolate;ethane;zinc |
| PubChem CID | 159834857 |
| Molecular Formula | C9H11N2SZn- |
| Molecular Weight | 244.66 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | 1H-benzimidazole-2-thiolate;ethane;zinc |
| SMILES | CC.[S-]c1nc2ccccc2[nH]1.[Zn] |
| InChI | InChI=1S/C7H6N2S.C2H6.Zn/c10-7-8-5-3-1-2-4-6(5)9-7;1-2;/h1-4H,(H2,8,9,10);1-2H3;/p-1 |
| InChIKey | SWDWIODYRPBXPV-UHFFFAOYSA-M |
| XLogP | 2.49 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.66 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 1H-benzimidazole-2-thiolate;ethane;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-benzimidazole-2-thiolate;ethane;zinc?
The IUPAC name of 1H-benzimidazole-2-thiolate;ethane;zinc (CID 159834857) is 1H-benzimidazole-2-thiolate;ethane;zinc.
What is the SMILES notation for 1H-benzimidazole-2-thiolate;ethane;zinc?
The canonical SMILES for 1H-benzimidazole-2-thiolate;ethane;zinc is CC.[S-]c1nc2ccccc2[nH]1.[Zn].
What is the InChIKey of 1H-benzimidazole-2-thiolate;ethane;zinc?
The InChIKey is SWDWIODYRPBXPV-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H6N2S.C2H6.Zn/c10-7-8-5-3-1-2-4-6(5)9-7;1-2;/h1-4H,(H2,8,9,10);1-2H3;/p-1.
What are the key properties of 1H-benzimidazole-2-thiolate;ethane;zinc?
1H-benzimidazole-2-thiolate;ethane;zinc has a molecular weight of 244.66 g/mol, XLogP of 2.49, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-benzimidazole-2-thiolate;ethane;zinc is sourced from PubChem (CID 159834857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).