C9H11N3 — CID 17846
N,N-dimethyl-1H-benzimidazol-2-amine (PubChem CID 17846) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is N,N-dimethyl-1H-benzimidazol-2-amine.
| Compound Name | N,N-dimethyl-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 17846 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | N,N-dimethyl-1H-benzimidazol-2-amine |
| SMILES | CN(C)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C9H11N3/c1-12(2)9-10-7-5-3-4-6-8(7)11-9/h3-6H,1-2H3,(H,10,11) |
| InChIKey | NMTCCVZABWWGSB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |