C12H17N3 — CID 71723451
N-butyl-N-methyl-1H-benzimidazol-2-amine (PubChem CID 71723451) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is N-butyl-N-methyl-1H-benzimidazol-2-amine.
| Compound Name | N-butyl-N-methyl-1H-benzimidazol-2-amine |
|---|---|
| PubChem CID | 71723451 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | N-butyl-N-methyl-1H-benzimidazol-2-amine |
| SMILES | CCCCN(C)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C12H17N3/c1-3-4-9-15(2)12-13-10-7-5-6-8-11(10)14-12/h5-8H,3-4,9H2,1-2H3,(H,13,14) |
| InChIKey | ANLDJFLVPKZMGO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |