C14H22N4 — CID 112514528
1-(1H-benzimidazol-2-yl)-N-butyl-N-methylethane-1,2-diamine (PubChem CID 112514528) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is 1-(1H-benzimidazol-2-yl)-N-butyl-N-methylethane-1,2-diamine.
| Compound Name | 1-(1H-benzimidazol-2-yl)-N-butyl-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 112514528 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 1-(1H-benzimidazol-2-yl)-N-butyl-N-methylethane-1,2-diamine |
| SMILES | CCCCN(C)C(CN)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C14H22N4/c1-3-4-9-18(2)13(10-15)14-16-11-7-5-6-8-12(11)17-14/h5-8,13H,3-4,9-10,15H2,1-2H3,(H,16,17) |
| InChIKey | ZBUWNJBRCRHATD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |