C13H19N3O — CID 107203344
5-[1H-benzimidazol-2-yl(methyl)amino]pentan-1-ol (PubChem CID 107203344) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is 5-[1H-benzimidazol-2-yl(methyl)amino]pentan-1-ol.
| Compound Name | 5-[1H-benzimidazol-2-yl(methyl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 107203344 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 5-[1H-benzimidazol-2-yl(methyl)amino]pentan-1-ol |
| SMILES | CN(CCCCCO)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C13H19N3O/c1-16(9-5-2-6-10-17)13-14-11-7-3-4-8-12(11)15-13/h3-4,7-8,17H,2,5-6,9-10H2,1H3,(H,14,15) |
| InChIKey | VTSQHSZHTQUNMW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|