C14H12N4S2Zn — CID 58987087
zinc;1H-benzimidazole-2-thiolate;2,3-dihydro-1H-benzimidazole-2-thiolate (PubChem CID 58987087) has the molecular formula C14H12N4S2Zn and a molecular weight of 365.80 g/mol. Its IUPAC name is zinc;1H-benzimidazole-2-thiolate;2,3-dihydro-1H-benzimidazole-2-thiolate.
| Compound Name | zinc;1H-benzimidazole-2-thiolate;2,3-dihydro-1H-benzimidazole-2-thiolate |
|---|---|
| PubChem CID | 58987087 |
| Molecular Formula | C14H12N4S2Zn |
| Molecular Weight | 365.80 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | zinc;1H-benzimidazole-2-thiolate;2,3-dihydro-1H-benzimidazole-2-thiolate |
| SMILES | [S-]C1Nc2ccccc2N1.[S-]c1nc2ccccc2[nH]1.[Zn+2] |
| InChI | InChI=1S/C7H8N2S.C7H6N2S.Zn/c2*10-7-8-5-3-1-2-4-6(5)9-7;/h1-4,7-10H;1-4H,(H2,8,9,10);/q;;+2/p-2 |
| InChIKey | AWMKRRYVBNWBTG-UHFFFAOYSA-L |
| XLogP | 2.82 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.80 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|