C8H9ClN2 — CID 143998416
2-chloro-1H-benzimidazole;methane (PubChem CID 143998416) has the molecular formula C8H9ClN2 and a molecular weight of 168.63 g/mol. Its IUPAC name is 2-chloro-1H-benzimidazole;methane.
| Compound Name | 2-chloro-1H-benzimidazole;methane |
|---|---|
| PubChem CID | 143998416 |
| Molecular Formula | C8H9ClN2 |
| Molecular Weight | 168.63 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 2-chloro-1H-benzimidazole;methane |
| SMILES | C.Clc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C7H5ClN2.CH4/c8-7-9-5-3-1-2-4-6(5)10-7;/h1-4H,(H,9,10);1H4 |
| InChIKey | XSESYMRTCASPBT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.63 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |