C22H17BClN4O2S2 — CID 157451831
CID 157451831 (PubChem CID 157451831) has the molecular formula C22H17BClN4O2S2 and a molecular weight of 479.80 g/mol.
| Compound Name | CID 157451831 |
|---|---|
| PubChem CID | 157451831 |
| Molecular Formula | C22H17BClN4O2S2 |
| Molecular Weight | 479.80 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | — |
| SMILES | Clc1nc2ccccc2[nH]1.O[B]Oc1ccsc1.c1ccc2[nH]c(-c3ccsc3)nc2c1 |
| InChI | InChI=1S/C11H8N2S.C7H5ClN2.C4H4BO2S/c1-2-4-10-9(3-1)12-11(13-10)8-5-6-14-7-8;8-7-9-5-3-1-2-4-6(5)10-7;6-5-7-4-1-2-8-3-4/h1-7H,(H,12,13);1-4H,(H,9,10);1-3,6H |
| InChIKey | OJCGIBQATMQORL-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 86.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.80 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|