About 2-phenyl-1H-benzimidazole;zirconium(4+);tetrachloride
2-phenyl-1H-benzimidazole;zirconium(4+);tetrachloride (PubChem CID 173061121) has the molecular formula C13H10Cl4N2Zr
and a molecular weight of 427.27 g/mol. Its IUPAC name is 2-phenyl-1H-benzimidazole;zirconium(4+);tetrachloride.
Molecular Properties
| Compound Name | 2-phenyl-1H-benzimidazole;zirconium(4+);tetrachloride |
| PubChem CID | 173061121 |
| Molecular Formula | C13H10Cl4N2Zr |
| Molecular Weight | 427.27 g/mol |
| Exact Mass | 423.86 |
| IUPAC Name | 2-phenyl-1H-benzimidazole;zirconium(4+);tetrachloride |
| SMILES | [Cl-].[Cl-].[Cl-].[Cl-].[Zr+4].c1ccc(-c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C13H10N2.4ClH.Zr/c1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13;;;;;/h1-9H,(H,14,15);4*1H;/q;;;;;+4/p-4 |
| InChIKey | YFVFWOYMHAEGQL-UHFFFAOYSA-J |
| XLogP | -8.76 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.27 |
| LogP ≤ 5 | -8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-phenyl-1H-benzimidazole;zirconium(4+);tetrachloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-1H-benzimidazole;zirconium(4+);tetrachloride?
The IUPAC name of 2-phenyl-1H-benzimidazole;zirconium(4+);tetrachloride (CID 173061121) is 2-phenyl-1H-benzimidazole;zirconium(4+);tetrachloride.
What is the SMILES notation for 2-phenyl-1H-benzimidazole;zirconium(4+);tetrachloride?
The canonical SMILES for 2-phenyl-1H-benzimidazole;zirconium(4+);tetrachloride is [Cl-].[Cl-].[Cl-].[Cl-].[Zr+4].c1ccc(-c2nc3ccccc3[nH]2)cc1.
What is the InChIKey of 2-phenyl-1H-benzimidazole;zirconium(4+);tetrachloride?
The InChIKey is YFVFWOYMHAEGQL-UHFFFAOYSA-J. The full InChI is InChI=1S/C13H10N2.4ClH.Zr/c1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13;;;;;/h1-9H,(H,14,15);4*1H;/q;;;;;+4/p-4.
What are the key properties of 2-phenyl-1H-benzimidazole;zirconium(4+);tetrachloride?
2-phenyl-1H-benzimidazole;zirconium(4+);tetrachloride has a molecular weight of 427.27 g/mol, XLogP of -8.76, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-1H-benzimidazole;zirconium(4+);tetrachloride is sourced from PubChem (CID 173061121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).