C21H18N4O2 — CID 67481934
benzene-1,4-dicarboxamide;2-phenyl-1H-benzimidazole (PubChem CID 67481934) has the molecular formula C21H18N4O2 and a molecular weight of 358.40 g/mol. Its IUPAC name is benzene-1,4-dicarboxamide;2-phenyl-1H-benzimidazole.
| Compound Name | benzene-1,4-dicarboxamide;2-phenyl-1H-benzimidazole |
|---|---|
| PubChem CID | 67481934 |
| Molecular Formula | C21H18N4O2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | benzene-1,4-dicarboxamide;2-phenyl-1H-benzimidazole |
| SMILES | NC(=O)c1ccc(C(N)=O)cc1.c1ccc(-c2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C13H10N2.C8H8N2O2/c1-2-6-10(7-3-1)13-14-11-8-4-5-9-12(11)15-13;9-7(11)5-1-2-6(4-3-5)8(10)12/h1-9H,(H,14,15);1-4H,(H2,9,11)(H2,10,12) |
| InChIKey | WPOXKGMXXBKZJX-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 114.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |