C21H20N6O2 — CID 174846726
2-(4-aminophenyl)-3H-benzimidazol-5-amine;benzene-1,4-dicarboxamide (PubChem CID 174846726) has the molecular formula C21H20N6O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is 2-(4-aminophenyl)-3H-benzimidazol-5-amine;benzene-1,4-dicarboxamide.
| Compound Name | 2-(4-aminophenyl)-3H-benzimidazol-5-amine;benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 174846726 |
| Molecular Formula | C21H20N6O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 2-(4-aminophenyl)-3H-benzimidazol-5-amine;benzene-1,4-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(N)=O)cc1.Nc1ccc(-c2nc3ccc(N)cc3[nH]2)cc1 |
| InChI | InChI=1S/C13H12N4.C8H8N2O2/c14-9-3-1-8(2-4-9)13-16-11-6-5-10(15)7-12(11)17-13;9-7(11)5-1-2-6(4-3-5)8(10)12/h1-7H,14-15H2,(H,16,17);1-4H,(H2,9,11)(H2,10,12) |
| InChIKey | RSZHYGQWDMWYMB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 166.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|