C18H19N3O — CID 58408811
1-[2-(4-aminophenyl)-3H-benzimidazol-5-yl]-2,2-dimethylpropan-1-one (PubChem CID 58408811) has the molecular formula C18H19N3O and a molecular weight of 293.37 g/mol. Its IUPAC name is 1-[2-(4-aminophenyl)-3H-benzimidazol-5-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[2-(4-aminophenyl)-3H-benzimidazol-5-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 58408811 |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 1-[2-(4-aminophenyl)-3H-benzimidazol-5-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)c1ccc2nc(-c3ccc(N)cc3)[nH]c2c1 |
| InChI | InChI=1S/C18H19N3O/c1-18(2,3)16(22)12-6-9-14-15(10-12)21-17(20-14)11-4-7-13(19)8-5-11/h4-10H,19H2,1-3H3,(H,20,21) |
| InChIKey | HZLPCBCQSJIUNE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|