C19H21N3O2 — CID 58408680
1-[2-(4-amino-3-methoxyphenyl)-3H-benzimidazol-5-yl]-2,2-dimethylpropan-1-one (PubChem CID 58408680) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 1-[2-(4-amino-3-methoxyphenyl)-3H-benzimidazol-5-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[2-(4-amino-3-methoxyphenyl)-3H-benzimidazol-5-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 58408680 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 1-[2-(4-amino-3-methoxyphenyl)-3H-benzimidazol-5-yl]-2,2-dimethylpropan-1-one |
| SMILES | COc1cc(-c2nc3ccc(C(=O)C(C)(C)C)cc3[nH]2)ccc1N |
| InChI | InChI=1S/C19H21N3O2/c1-19(2,3)17(23)11-6-8-14-15(9-11)22-18(21-14)12-5-7-13(20)16(10-12)24-4/h5-10H,20H2,1-4H3,(H,21,22) |
| InChIKey | BISMEVNICZCIDL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|