C14H13N4O2P — CID 163541458
phosphanyl 2-(3,4-diaminophenyl)-3H-benzimidazole-5-carboxylate (PubChem CID 163541458) has the molecular formula C14H13N4O2P and a molecular weight of 300.26 g/mol. Its IUPAC name is phosphanyl 2-(3,4-diaminophenyl)-3H-benzimidazole-5-carboxylate.
| Compound Name | phosphanyl 2-(3,4-diaminophenyl)-3H-benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 163541458 |
| Molecular Formula | C14H13N4O2P |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | phosphanyl 2-(3,4-diaminophenyl)-3H-benzimidazole-5-carboxylate |
| SMILES | Nc1ccc(-c2nc3ccc(C(=O)OP)cc3[nH]2)cc1N |
| InChI | InChI=1S/C14H13N4O2P/c15-9-3-1-7(5-10(9)16)13-17-11-4-2-8(14(19)20-21)6-12(11)18-13/h1-6H,15-16,21H2,(H,17,18) |
| InChIKey | FBKUHBUFDQEALV-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|