About 2-(3,4-dimethoxyphenyl)-3H-benzimidazol-5-ol
2-(3,4-dimethoxyphenyl)-3H-benzimidazol-5-ol (PubChem CID 81432333) has the molecular formula C15H14N2O3
and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-3H-benzimidazol-5-ol.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)-3H-benzimidazol-5-ol |
| PubChem CID | 81432333 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-3H-benzimidazol-5-ol |
| SMILES | COc1ccc(-c2nc3ccc(O)cc3[nH]2)cc1OC |
| InChI | InChI=1S/C15H14N2O3/c1-19-13-6-3-9(7-14(13)20-2)15-16-11-5-4-10(18)8-12(11)17-15/h3-8,18H,1-2H3,(H,16,17) |
| InChIKey | MZOJZTRVBZGHDQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 67.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3,4-dimethoxyphenyl)-3H-benzimidazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)-3H-benzimidazol-5-ol?
The IUPAC name of 2-(3,4-dimethoxyphenyl)-3H-benzimidazol-5-ol (CID 81432333) is 2-(3,4-dimethoxyphenyl)-3H-benzimidazol-5-ol.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)-3H-benzimidazol-5-ol?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)-3H-benzimidazol-5-ol is COc1ccc(-c2nc3ccc(O)cc3[nH]2)cc1OC.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)-3H-benzimidazol-5-ol?
The InChIKey is MZOJZTRVBZGHDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O3/c1-19-13-6-3-9(7-14(13)20-2)15-16-11-5-4-10(18)8-12(11)17-15/h3-8,18H,1-2H3,(H,16,17).
What are the key properties of 2-(3,4-dimethoxyphenyl)-3H-benzimidazol-5-ol?
2-(3,4-dimethoxyphenyl)-3H-benzimidazol-5-ol has a molecular weight of 270.29 g/mol, XLogP of 2.95, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)-3H-benzimidazol-5-ol is sourced from PubChem (CID 81432333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).