C25H39N3O3 — CID 135953359
4-[5-[(Z,8R)-8-hydroxyheptadec-11-enyl]-1H-1,2,4-triazol-3-yl]benzene-1,2-diol (PubChem CID 135953359) has the molecular formula C25H39N3O3 and a molecular weight of 429.61 g/mol. Its IUPAC name is 4-[5-[(Z,8R)-8-hydroxyheptadec-11-enyl]-1H-1,2,4-triazol-3-yl]benzene-1,2-diol.
| Compound Name | 4-[5-[(Z,8R)-8-hydroxyheptadec-11-enyl]-1H-1,2,4-triazol-3-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 135953359 |
| Molecular Formula | C25H39N3O3 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.30 |
| IUPAC Name | 4-[5-[(Z,8R)-8-hydroxyheptadec-11-enyl]-1H-1,2,4-triazol-3-yl]benzene-1,2-diol |
| SMILES | CCCCC/C=C\CC[C@H](O)CCCCCCCc1nc(-c2ccc(O)c(O)c2)n[nH]1 |
| InChI | InChI=1S/C25H39N3O3/c1-2-3-4-5-6-8-11-14-21(29)15-12-9-7-10-13-16-24-26-25(28-27-24)20-17-18-22(30)23(31)19-20/h6,8,17-19,21,29-31H,2-5,7,9-16H2,1H3,(H,26,27,28)/b8-6-/t21-/m0/s1 |
| InChIKey | LFMVQOXVYYQCJW-LHFJYWTJSA-N |
| XLogP | 6.04 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|