C19H36N4 — CID 14767757
5-[(Z)-heptadec-8-enyl]-1H-1,2,4-triazol-3-amine (PubChem CID 14767757) has the molecular formula C19H36N4 and a molecular weight of 320.52 g/mol. Its IUPAC name is 5-[(Z)-heptadec-8-enyl]-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-[(Z)-heptadec-8-enyl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 14767757 |
| Molecular Formula | C19H36N4 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.29 |
| IUPAC Name | 5-[(Z)-heptadec-8-enyl]-1H-1,2,4-triazol-3-amine |
| SMILES | CCCCCCCC/C=C\CCCCCCCc1nc(N)n[nH]1 |
| InChI | InChI=1S/C19H36N4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21-19(20)23-22-18/h9-10H,2-8,11-17H2,1H3,(H3,20,21,22,23)/b10-9- |
| InChIKey | MUXVJUQXGAMEHK-KTKRTIGZSA-N |
| XLogP | 5.58 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|