C18H36N4 — CID 70261193
5-hexadecyl-1H-1,2,4-triazol-3-amine (PubChem CID 70261193) has the molecular formula C18H36N4 and a molecular weight of 308.51 g/mol. Its IUPAC name is 5-hexadecyl-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-hexadecyl-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 70261193 |
| Molecular Formula | C18H36N4 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.29 |
| IUPAC Name | 5-hexadecyl-1H-1,2,4-triazol-3-amine |
| SMILES | CCCCCCCCCCCCCCCCc1nc(N)n[nH]1 |
| InChI | InChI=1S/C18H36N4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20-18(19)22-21-17/h2-16H2,1H3,(H3,19,20,21,22) |
| InChIKey | MFIGCOINAPYEET-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|