About 5-pentadecyl-1H-1,2,4-triazol-3-amine
5-pentadecyl-1H-1,2,4-triazol-3-amine (PubChem CID 6421777) has the molecular formula C17H34N4
and a molecular weight of 294.49 g/mol. Its IUPAC name is 5-pentadecyl-1H-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 5-pentadecyl-1H-1,2,4-triazol-3-amine |
| PubChem CID | 6421777 |
| Molecular Formula | C17H34N4 |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 294.28 |
| IUPAC Name | 5-pentadecyl-1H-1,2,4-triazol-3-amine |
| SMILES | CCCCCCCCCCCCCCCc1nc(N)n[nH]1 |
| InChI | InChI=1S/C17H34N4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-17(18)21-20-16/h2-15H2,1H3,(H3,18,19,20,21) |
| InChIKey | CYWQCHCXTRIKDD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-pentadecyl-1H-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pentadecyl-1H-1,2,4-triazol-3-amine?
The IUPAC name of 5-pentadecyl-1H-1,2,4-triazol-3-amine (CID 6421777) is 5-pentadecyl-1H-1,2,4-triazol-3-amine.
What is the SMILES notation for 5-pentadecyl-1H-1,2,4-triazol-3-amine?
The canonical SMILES for 5-pentadecyl-1H-1,2,4-triazol-3-amine is CCCCCCCCCCCCCCCc1nc(N)n[nH]1.
What is the InChIKey of 5-pentadecyl-1H-1,2,4-triazol-3-amine?
The InChIKey is CYWQCHCXTRIKDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34N4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-17(18)21-20-16/h2-15H2,1H3,(H3,18,19,20,21).
What are the key properties of 5-pentadecyl-1H-1,2,4-triazol-3-amine?
5-pentadecyl-1H-1,2,4-triazol-3-amine has a molecular weight of 294.49 g/mol, XLogP of 5.02, 14 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pentadecyl-1H-1,2,4-triazol-3-amine is sourced from PubChem (CID 6421777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).