C17H34N4 — CID 6421777
5-pentadecyl-1H-1,2,4-triazol-3-amine (PubChem CID 6421777) has the molecular formula C17H34N4 and a molecular weight of 294.49 g/mol. Its IUPAC name is 5-pentadecyl-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-pentadecyl-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 6421777 |
| Molecular Formula | C17H34N4 |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 294.28 |
| IUPAC Name | 5-pentadecyl-1H-1,2,4-triazol-3-amine |
| SMILES | CCCCCCCCCCCCCCCc1nc(N)n[nH]1 |
| InChI | InChI=1S/C17H34N4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-17(18)21-20-16/h2-15H2,1H3,(H3,18,19,20,21) |
| InChIKey | CYWQCHCXTRIKDD-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|