5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride

C8H14ClN3O2S — CID 114754388

IUPAC5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride
SMILESCCCCCCc1nc(S(=O)(=O)Cl)n[nH]1
InChIInChI=1S/C8H14ClN3O2S/c1-2-3-4-5-6-7-10-8(12-11-7)15(9,13)14/h2-6H2,1H3,(H,10,11,12)
InChIKeyQQOICZJUPJXWBC-UHFFFAOYSA-N
MW251.74 g/mol
LogP1.86
Rot. Bonds6

About 5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride

5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride (PubChem CID 114754388) has the molecular formula C8H14ClN3O2S and a molecular weight of 251.74 g/mol. Its IUPAC name is 5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride.

Molecular Properties

Compound Name5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride
PubChem CID114754388
Molecular FormulaC8H14ClN3O2S
Molecular Weight251.74 g/mol
Exact Mass251.05
IUPAC Name5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride
SMILESCCCCCCc1nc(S(=O)(=O)Cl)n[nH]1
InChIInChI=1S/C8H14ClN3O2S/c1-2-3-4-5-6-7-10-8(12-11-7)15(9,13)14/h2-6H2,1H3,(H,10,11,12)
InChIKeyQQOICZJUPJXWBC-UHFFFAOYSA-N
XLogP1.86
TPSA75.71 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.74
LogP ≤ 51.86
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride?
The IUPAC name of 5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride (CID 114754388) is 5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride.
What is the SMILES notation for 5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride?
The canonical SMILES for 5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride is CCCCCCc1nc(S(=O)(=O)Cl)n[nH]1.
What is the InChIKey of 5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride?
The InChIKey is QQOICZJUPJXWBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14ClN3O2S/c1-2-3-4-5-6-7-10-8(12-11-7)15(9,13)14/h2-6H2,1H3,(H,10,11,12).
What are the key properties of 5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride?
5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride has a molecular weight of 251.74 g/mol, XLogP of 1.86, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride is sourced from PubChem (CID 114754388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).