C8H14ClN3O2S — CID 114754388
5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride (PubChem CID 114754388) has the molecular formula C8H14ClN3O2S and a molecular weight of 251.74 g/mol. Its IUPAC name is 5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride.
| Compound Name | 5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride |
|---|---|
| PubChem CID | 114754388 |
| Molecular Formula | C8H14ClN3O2S |
| Molecular Weight | 251.74 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride |
| SMILES | CCCCCCc1nc(S(=O)(=O)Cl)n[nH]1 |
| InChI | InChI=1S/C8H14ClN3O2S/c1-2-3-4-5-6-7-10-8(12-11-7)15(9,13)14/h2-6H2,1H3,(H,10,11,12) |
| InChIKey | QQOICZJUPJXWBC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.74 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|