About 5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride
5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride (PubChem CID 114754388) has the molecular formula C8H14ClN3O2S
and a molecular weight of 251.74 g/mol. Its IUPAC name is 5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride.
Molecular Properties
| Compound Name | 5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride |
| PubChem CID | 114754388 |
| Molecular Formula | C8H14ClN3O2S |
| Molecular Weight | 251.74 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride |
| SMILES | CCCCCCc1nc(S(=O)(=O)Cl)n[nH]1 |
| InChI | InChI=1S/C8H14ClN3O2S/c1-2-3-4-5-6-7-10-8(12-11-7)15(9,13)14/h2-6H2,1H3,(H,10,11,12) |
| InChIKey | QQOICZJUPJXWBC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.74 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride?
The IUPAC name of 5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride (CID 114754388) is 5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride.
What is the SMILES notation for 5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride?
The canonical SMILES for 5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride is CCCCCCc1nc(S(=O)(=O)Cl)n[nH]1.
What is the InChIKey of 5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride?
The InChIKey is QQOICZJUPJXWBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14ClN3O2S/c1-2-3-4-5-6-7-10-8(12-11-7)15(9,13)14/h2-6H2,1H3,(H,10,11,12).
What are the key properties of 5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride?
5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride has a molecular weight of 251.74 g/mol, XLogP of 1.86, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hexyl-1H-1,2,4-triazole-3-sulfonyl chloride is sourced from PubChem (CID 114754388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).