C9H17N3O — CID 137199810
3-heptyl-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 137199810) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is 3-heptyl-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-heptyl-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 137199810 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 3-heptyl-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | CCCCCCCc1n[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C9H17N3O/c1-2-3-4-5-6-7-8-10-9(13)12-11-8/h2-7H2,1H3,(H2,10,11,12,13) |
| InChIKey | RLJGUXRLHYCKHH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|