C4H7N3O2 — CID 136968138
3-(2-hydroxyethyl)-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 136968138) has the molecular formula C4H7N3O2 and a molecular weight of 129.12 g/mol. Its IUPAC name is 3-(2-hydroxyethyl)-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-(2-hydroxyethyl)-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 136968138 |
| Molecular Formula | C4H7N3O2 |
| Molecular Weight | 129.12 g/mol |
| Exact Mass | 129.05 |
| IUPAC Name | 3-(2-hydroxyethyl)-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]nc(CCO)[nH]1 |
| InChI | InChI=1S/C4H7N3O2/c8-2-1-3-5-4(9)7-6-3/h8H,1-2H2,(H2,5,6,7,9) |
| InChIKey | MTCNJKTUYNQQRJ-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 81.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.12 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |