About 2-undecyl-1H-thieno[3,4-d]imidazole
2-undecyl-1H-thieno[3,4-d]imidazole (PubChem CID 21199937) has the molecular formula C16H26N2S
and a molecular weight of 278.46 g/mol. Its IUPAC name is 2-undecyl-1H-thieno[3,4-d]imidazole.
Molecular Properties
| Compound Name | 2-undecyl-1H-thieno[3,4-d]imidazole |
| PubChem CID | 21199937 |
| Molecular Formula | C16H26N2S |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 2-undecyl-1H-thieno[3,4-d]imidazole |
| SMILES | CCCCCCCCCCCc1nc2cscc2[nH]1 |
| InChI | InChI=1S/C16H26N2S/c1-2-3-4-5-6-7-8-9-10-11-16-17-14-12-19-13-15(14)18-16/h12-13H,2-11H2,1H3,(H,17,18) |
| InChIKey | DADVSMGNDKIGOG-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-undecyl-1H-thieno[3,4-d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-undecyl-1H-thieno[3,4-d]imidazole?
The IUPAC name of 2-undecyl-1H-thieno[3,4-d]imidazole (CID 21199937) is 2-undecyl-1H-thieno[3,4-d]imidazole.
What is the SMILES notation for 2-undecyl-1H-thieno[3,4-d]imidazole?
The canonical SMILES for 2-undecyl-1H-thieno[3,4-d]imidazole is CCCCCCCCCCCc1nc2cscc2[nH]1.
What is the InChIKey of 2-undecyl-1H-thieno[3,4-d]imidazole?
The InChIKey is DADVSMGNDKIGOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2S/c1-2-3-4-5-6-7-8-9-10-11-16-17-14-12-19-13-15(14)18-16/h12-13H,2-11H2,1H3,(H,17,18).
What are the key properties of 2-undecyl-1H-thieno[3,4-d]imidazole?
2-undecyl-1H-thieno[3,4-d]imidazole has a molecular weight of 278.46 g/mol, XLogP of 5.70, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-undecyl-1H-thieno[3,4-d]imidazole is sourced from PubChem (CID 21199937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).