C19H32N2S — CID 91357795
2-tetradecan-2-yl-1H-thieno[3,4-d]imidazole (PubChem CID 91357795) has the molecular formula C19H32N2S and a molecular weight of 320.55 g/mol. Its IUPAC name is 2-tetradecan-2-yl-1H-thieno[3,4-d]imidazole.
| Compound Name | 2-tetradecan-2-yl-1H-thieno[3,4-d]imidazole |
|---|---|
| PubChem CID | 91357795 |
| Molecular Formula | C19H32N2S |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | 2-tetradecan-2-yl-1H-thieno[3,4-d]imidazole |
| SMILES | CCCCCCCCCCCCC(C)c1nc2cscc2[nH]1 |
| InChI | InChI=1S/C19H32N2S/c1-3-4-5-6-7-8-9-10-11-12-13-16(2)19-20-17-14-22-15-18(17)21-19/h14-16H,3-13H2,1-2H3,(H,20,21) |
| InChIKey | GUDWFPZDHOKKLU-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|