C18H34N2O2 — CID 138558356
3-hexadecan-2-yl-4H-1,2,4-oxadiazol-5-one (PubChem CID 138558356) has the molecular formula C18H34N2O2 and a molecular weight of 310.48 g/mol. Its IUPAC name is 3-hexadecan-2-yl-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-hexadecan-2-yl-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 138558356 |
| Molecular Formula | C18H34N2O2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.26 |
| IUPAC Name | 3-hexadecan-2-yl-4H-1,2,4-oxadiazol-5-one |
| SMILES | CCCCCCCCCCCCCCC(C)c1noc(=O)[nH]1 |
| InChI | InChI=1S/C18H34N2O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16(2)17-19-18(21)22-20-17/h16H,3-15H2,1-2H3,(H,19,20,21) |
| InChIKey | RXINNZWFQJADJL-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|