About 3-propyl-4H-1,2,4-oxadiazol-5-one
3-propyl-4H-1,2,4-oxadiazol-5-one (PubChem CID 170707204) has the molecular formula C10H16N4O4
and a molecular weight of 256.26 g/mol. Its IUPAC name is 3-propyl-4H-1,2,4-oxadiazol-5-one.
Molecular Properties
| Compound Name | 3-propyl-4H-1,2,4-oxadiazol-5-one |
| PubChem CID | 170707204 |
| Molecular Formula | C10H16N4O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 3-propyl-4H-1,2,4-oxadiazol-5-one |
| SMILES | CCCc1noc(=O)[nH]1.CCCc1noc(=O)[nH]1 |
| InChI | InChI=1S/2C5H8N2O2/c2*1-2-3-4-6-5(8)9-7-4/h2*2-3H2,1H3,(H,6,7,8) |
| InChIKey | PCWBPGSSPPWFJN-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-propyl-4H-1,2,4-oxadiazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propyl-4H-1,2,4-oxadiazol-5-one?
The IUPAC name of 3-propyl-4H-1,2,4-oxadiazol-5-one (CID 170707204) is 3-propyl-4H-1,2,4-oxadiazol-5-one.
What is the SMILES notation for 3-propyl-4H-1,2,4-oxadiazol-5-one?
The canonical SMILES for 3-propyl-4H-1,2,4-oxadiazol-5-one is CCCc1noc(=O)[nH]1.CCCc1noc(=O)[nH]1.
What is the InChIKey of 3-propyl-4H-1,2,4-oxadiazol-5-one?
The InChIKey is PCWBPGSSPPWFJN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H8N2O2/c2*1-2-3-4-6-5(8)9-7-4/h2*2-3H2,1H3,(H,6,7,8).
What are the key properties of 3-propyl-4H-1,2,4-oxadiazol-5-one?
3-propyl-4H-1,2,4-oxadiazol-5-one has a molecular weight of 256.26 g/mol, XLogP of 0.63, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propyl-4H-1,2,4-oxadiazol-5-one is sourced from PubChem (CID 170707204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).