C11H12N2O3 — CID 136964550
3-[ethoxy(phenyl)methyl]-4H-1,2,4-oxadiazol-5-one (PubChem CID 136964550) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 3-[ethoxy(phenyl)methyl]-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[ethoxy(phenyl)methyl]-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 136964550 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 3-[ethoxy(phenyl)methyl]-4H-1,2,4-oxadiazol-5-one |
| SMILES | CCOC(c1ccccc1)c1noc(=O)[nH]1 |
| InChI | InChI=1S/C11H12N2O3/c1-2-15-9(8-6-4-3-5-7-8)10-12-11(14)16-13-10/h3-7,9H,2H2,1H3,(H,12,13,14) |
| InChIKey | NBHCRBFWDNNWIO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |