C12H16N2O — CID 119089815
2-[ethoxy(phenyl)methyl]-4,5-dihydro-1H-imidazole (PubChem CID 119089815) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-[ethoxy(phenyl)methyl]-4,5-dihydro-1H-imidazole.
| Compound Name | 2-[ethoxy(phenyl)methyl]-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 119089815 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 2-[ethoxy(phenyl)methyl]-4,5-dihydro-1H-imidazole |
| SMILES | CCOC(C1=NCCN1)c1ccccc1 |
| InChI | InChI=1S/C12H16N2O/c1-2-15-11(12-13-8-9-14-12)10-6-4-3-5-7-10/h3-7,11H,2,8-9H2,1H3,(H,13,14) |
| InChIKey | CWTIISVKYWUXIW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |