About CID 56851103
CID 56851103 (PubChem CID 56851103) has the molecular formula C19H20FeO+2
and a molecular weight of 320.21 g/mol.
Molecular Properties
| Compound Name | CID 56851103 |
| PubChem CID | 56851103 |
| Molecular Formula | C19H20FeO+2 |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | — |
| SMILES | CCOC([C]1[CH][CH][CH][CH]1)c1ccccc1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C14H15O.C5H5.Fe/c1-2-15-14(13-10-6-7-11-13)12-8-4-3-5-9-12;1-2-4-5-3-1;/h3-11,14H,2H2,1H3;1-5H;/q;;+2 |
| InChIKey | CLMDJUYYQGVXQK-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 56851103 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 56851103?
The IUPAC name of CID 56851103 (CID 56851103) is not available.
What is the SMILES notation for CID 56851103?
The canonical SMILES for CID 56851103 is CCOC([C]1[CH][CH][CH][CH]1)c1ccccc1.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 56851103?
The InChIKey is CLMDJUYYQGVXQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15O.C5H5.Fe/c1-2-15-14(13-10-6-7-11-13)12-8-4-3-5-9-12;1-2-4-5-3-1;/h3-11,14H,2H2,1H3;1-5H;/q;;+2.
What are the key properties of CID 56851103?
CID 56851103 has a molecular weight of 320.21 g/mol, XLogP of 4.19, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 56851103 is sourced from PubChem (CID 56851103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).