About CID 56851104
CID 56851104 (PubChem CID 56851104) has the molecular formula C14H15O
and a molecular weight of 199.27 g/mol.
Molecular Properties
| Compound Name | CID 56851104 |
| PubChem CID | 56851104 |
| Molecular Formula | C14H15O |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | — |
| SMILES | CCOC([C]1[CH][CH][CH][CH]1)c1ccccc1 |
| InChI | InChI=1S/C14H15O/c1-2-15-14(13-10-6-7-11-13)12-8-4-3-5-9-12/h3-11,14H,2H2,1H3 |
| InChIKey | OWCYLXFZVNIJGQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 56851104 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 56851104?
The IUPAC name of CID 56851104 (CID 56851104) is not available.
What is the SMILES notation for CID 56851104?
The canonical SMILES for CID 56851104 is CCOC([C]1[CH][CH][CH][CH]1)c1ccccc1.
What is the InChIKey of CID 56851104?
The InChIKey is OWCYLXFZVNIJGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15O/c1-2-15-14(13-10-6-7-11-13)12-8-4-3-5-9-12/h3-11,14H,2H2,1H3.
What are the key properties of CID 56851104?
CID 56851104 has a molecular weight of 199.27 g/mol, XLogP of 3.17, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 56851104 is sourced from PubChem (CID 56851104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).