About 2-nonan-2-ylfuran
2-nonan-2-ylfuran (PubChem CID 160791396) has the molecular formula C13H22O
and a molecular weight of 194.32 g/mol. Its IUPAC name is 2-nonan-2-ylfuran.
Molecular Properties
| Compound Name | 2-nonan-2-ylfuran |
| PubChem CID | 160791396 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 2-nonan-2-ylfuran |
| SMILES | CCCCCCCC(C)c1ccco1 |
| InChI | InChI=1S/C13H22O/c1-3-4-5-6-7-9-12(2)13-10-8-11-14-13/h8,10-12H,3-7,9H2,1-2H3 |
| InChIKey | LGFNXHKSWZOTEM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-nonan-2-ylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nonan-2-ylfuran?
The IUPAC name of 2-nonan-2-ylfuran (CID 160791396) is 2-nonan-2-ylfuran.
What is the SMILES notation for 2-nonan-2-ylfuran?
The canonical SMILES for 2-nonan-2-ylfuran is CCCCCCCC(C)c1ccco1.
What is the InChIKey of 2-nonan-2-ylfuran?
The InChIKey is LGFNXHKSWZOTEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O/c1-3-4-5-6-7-9-12(2)13-10-8-11-14-13/h8,10-12H,3-7,9H2,1-2H3.
What are the key properties of 2-nonan-2-ylfuran?
2-nonan-2-ylfuran has a molecular weight of 194.32 g/mol, XLogP of 4.74, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nonan-2-ylfuran is sourced from PubChem (CID 160791396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).