C18H25NO — CID 81403415
N-[(1R)-1-(furan-2-yl)ethyl]-1-phenylhexan-1-amine (PubChem CID 81403415) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is N-[(1R)-1-(furan-2-yl)ethyl]-1-phenylhexan-1-amine.
| Compound Name | N-[(1R)-1-(furan-2-yl)ethyl]-1-phenylhexan-1-amine |
|---|---|
| PubChem CID | 81403415 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | N-[(1R)-1-(furan-2-yl)ethyl]-1-phenylhexan-1-amine |
| SMILES | CCCCCC(N[C@H](C)c1ccco1)c1ccccc1 |
| InChI | InChI=1S/C18H25NO/c1-3-4-6-12-17(16-10-7-5-8-11-16)19-15(2)18-13-9-14-20-18/h5,7-11,13-15,17,19H,3-4,6,12H2,1-2H3/t15-,17?/m1/s1 |
| InChIKey | XVZYSTRPBPXBNN-LDCVWXEPSA-N |
| XLogP | 5.25 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|