C17H23NO — CID 81403395
1-(4-ethylphenyl)-N-[(1R)-1-(furan-2-yl)ethyl]propan-1-amine (PubChem CID 81403395) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-N-[(1R)-1-(furan-2-yl)ethyl]propan-1-amine.
| Compound Name | 1-(4-ethylphenyl)-N-[(1R)-1-(furan-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 81403395 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 1-(4-ethylphenyl)-N-[(1R)-1-(furan-2-yl)ethyl]propan-1-amine |
| SMILES | CCc1ccc(C(CC)N[C@H](C)c2ccco2)cc1 |
| InChI | InChI=1S/C17H23NO/c1-4-14-8-10-15(11-9-14)16(5-2)18-13(3)17-7-6-12-19-17/h6-13,16,18H,4-5H2,1-3H3/t13-,16?/m1/s1 |
| InChIKey | PGNOSBQVIALARC-JBZHPUCOSA-N |
| XLogP | 4.64 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |