C17H32N2O2 — CID 137233049
3-pentadecan-8-yl-4H-1,2,4-oxadiazol-5-one (PubChem CID 137233049) has the molecular formula C17H32N2O2 and a molecular weight of 296.45 g/mol. Its IUPAC name is 3-pentadecan-8-yl-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-pentadecan-8-yl-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 137233049 |
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 3-pentadecan-8-yl-4H-1,2,4-oxadiazol-5-one |
| SMILES | CCCCCCCC(CCCCCCC)c1noc(=O)[nH]1 |
| InChI | InChI=1S/C17H32N2O2/c1-3-5-7-9-11-13-15(14-12-10-8-6-4-2)16-18-17(20)21-19-16/h15H,3-14H2,1-2H3,(H,18,19,20) |
| InChIKey | JQPWISVQHZTMCU-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|