C16H29NO — CID 155322421
4-ethyl-3-undecan-5-yl-1,2-oxazole (PubChem CID 155322421) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is 4-ethyl-3-undecan-5-yl-1,2-oxazole.
| Compound Name | 4-ethyl-3-undecan-5-yl-1,2-oxazole |
|---|---|
| PubChem CID | 155322421 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | 4-ethyl-3-undecan-5-yl-1,2-oxazole |
| SMILES | CCCCCCC(CCCC)c1nocc1CC |
| InChI | InChI=1S/C16H29NO/c1-4-7-9-10-12-15(11-8-5-2)16-14(6-3)13-18-17-16/h13,15H,4-12H2,1-3H3 |
| InChIKey | YIFYGSGTTGYKKE-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|